C19H20N4O3S2 — CID 4809633
2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4809633) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4809633 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H20N4O3S2/c24-18(13-27-19-21-16-8-1-2-9-17(16)22-19)20-14-6-5-7-15(12-14)28(25,26)23-10-3-4-11-23/h1-2,5-9,12H,3-4,10-11,13H2,(H,20,24)(H,21,22) |
| InChIKey | RYOACUBZBUNGLF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |