C22H26N4O4S2 — CID 4042810
N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 4042810) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4042810 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccc2nc(SCC(=O)Nc3cccc(S(=O)(=O)N4CCCCCC4)c3)[nH]c2c1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-30-17-9-10-19-20(14-17)25-22(24-19)31-15-21(27)23-16-7-6-8-18(13-16)32(28,29)26-11-4-2-3-5-12-26/h6-10,13-14H,2-5,11-12,15H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | SCXSVLYXUBRGOD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |