C15H10F2N2OS — CID 43218350
2-(1H-benzimidazol-2-ylsulfanyl)-1-(2,5-difluorophenyl)ethanone (PubChem CID 43218350) has the molecular formula C15H10F2N2OS and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 43218350 |
| Molecular Formula | C15H10F2N2OS |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(2,5-difluorophenyl)ethanone |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F2N2OS/c16-9-5-6-11(17)10(7-9)14(20)8-21-15-18-12-3-1-2-4-13(12)19-15/h1-7H,8H2,(H,18,19) |
| InChIKey | LEYQOCDUSLDVFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |