C17H12N2O2S — CID 2335628
2-(1H-benzimidazol-2-ylsulfanyl)-1-(1-benzofuran-2-yl)ethanone (PubChem CID 2335628) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-1-(1-benzofuran-2-yl)ethanone.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 2335628 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(1-benzofuran-2-yl)ethanone |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H12N2O2S/c20-14(16-9-11-5-1-4-8-15(11)21-16)10-22-17-18-12-6-2-3-7-13(12)19-17/h1-9H,10H2,(H,18,19) |
| InChIKey | GTVYMFVEPKWDEH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |