C14H12N2O3S — CID 539647
4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylic acid (PubChem CID 539647) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 539647 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N2O3S/c1-8-9(6-12(19-8)13(17)18)7-20-14-15-10-4-2-3-5-11(10)16-14/h2-6H,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | TXDVBNQNJFQOQY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |