C16H15N3OS2 — CID 142063324
S-[3-(1H-benzimidazol-2-ylsulfanylmethyl)-2-methylphenyl] carbamothioate (PubChem CID 142063324) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is S-[3-(1H-benzimidazol-2-ylsulfanylmethyl)-2-methylphenyl] carbamothioate.
| Compound Name | S-[3-(1H-benzimidazol-2-ylsulfanylmethyl)-2-methylphenyl] carbamothioate |
|---|---|
| PubChem CID | 142063324 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | S-[3-(1H-benzimidazol-2-ylsulfanylmethyl)-2-methylphenyl] carbamothioate |
| SMILES | Cc1c(CSc2nc3ccccc3[nH]2)cccc1SC(N)=O |
| InChI | InChI=1S/C16H15N3OS2/c1-10-11(5-4-8-14(10)22-15(17)20)9-21-16-18-12-6-2-3-7-13(12)19-16/h2-8H,9H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | OVILIFFAIMLQSZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|