About 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide
2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide (PubChem CID 60520349) has the molecular formula C21H25N3OS
and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide.
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide |
| PubChem CID | 60520349 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccccc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H25N3OS/c1-3-13-24(14-4-2)20(25)17-10-6-5-9-16(17)15-26-21-22-18-11-7-8-12-19(18)23-21/h5-12H,3-4,13-15H2,1-2H3,(H,22,23) |
| InChIKey | QATWCYSVPXEJNY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide?
The IUPAC name of 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide (CID 60520349) is 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide.
What is the SMILES notation for 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide?
The canonical SMILES for 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide is CCCN(CCC)C(=O)c1ccccc1CSc1nc2ccccc2[nH]1.
What is the InChIKey of 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide?
The InChIKey is QATWCYSVPXEJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3OS/c1-3-13-24(14-4-2)20(25)17-10-6-5-9-16(17)15-26-21-22-18-11-7-8-12-19(18)23-21/h5-12H,3-4,13-15H2,1-2H3,(H,22,23).
What are the key properties of 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide?
2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide has a molecular weight of 367.52 g/mol, XLogP of 5.12, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N,N-dipropylbenzamide is sourced from PubChem (CID 60520349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).