C18H19N3O2S — CID 78796351
2-(1H-benzimidazol-2-ylsulfanylmethyl)-N-(3-hydroxypropyl)benzamide (PubChem CID 78796351) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N-(3-hydroxypropyl)benzamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N-(3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 78796351 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)-N-(3-hydroxypropyl)benzamide |
| SMILES | O=C(NCCCO)c1ccccc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H19N3O2S/c22-11-5-10-19-17(23)14-7-2-1-6-13(14)12-24-18-20-15-8-3-4-9-16(15)21-18/h1-4,6-9,22H,5,10-12H2,(H,19,23)(H,20,21) |
| InChIKey | PCUFAHVNNYNPEU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|