C21H26N4OS — CID 119641397
N-(2-amino-2-ethylbutyl)-2-(1H-benzimidazol-2-ylsulfanylmethyl)benzamide (PubChem CID 119641397) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-(1H-benzimidazol-2-ylsulfanylmethyl)benzamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-(1H-benzimidazol-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 119641397 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-(1H-benzimidazol-2-ylsulfanylmethyl)benzamide |
| SMILES | CCC(N)(CC)CNC(=O)c1ccccc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H26N4OS/c1-3-21(22,4-2)14-23-19(26)16-10-6-5-9-15(16)13-27-20-24-17-11-7-8-12-18(17)25-20/h5-12H,3-4,13-14,22H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | LRJSYOOIDZBEHT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |