C14H11N2O3S- — CID 7056112
4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylate (PubChem CID 7056112) has the molecular formula C14H11N2O3S- and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylate.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 7056112 |
| Molecular Formula | C14H11N2O3S- |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-5-methylfuran-2-carboxylate |
| SMILES | Cc1oc(C(=O)[O-])cc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N2O3S/c1-8-9(6-12(19-8)13(17)18)7-20-14-15-10-4-2-3-5-11(10)16-14/h2-6H,7H2,1H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | TXDVBNQNJFQOQY-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |