C12H8N2O3S — CID 62206739
5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid (PubChem CID 62206739) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62206739 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C12H8N2O3S/c15-11(16)9-5-6-10(17-9)18-12-13-7-3-1-2-4-8(7)14-12/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | IXZCZPDMLXLLKE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |