C14H9BrN2O2S — CID 114896212
2-(1H-benzimidazol-2-ylsulfanyl)-5-bromobenzoic acid (PubChem CID 114896212) has the molecular formula C14H9BrN2O2S and a molecular weight of 349.21 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-5-bromobenzoic acid.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-5-bromobenzoic acid |
|---|---|
| PubChem CID | 114896212 |
| Molecular Formula | C14H9BrN2O2S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-5-bromobenzoic acid |
| SMILES | O=C(O)c1cc(Br)ccc1Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H9BrN2O2S/c15-8-5-6-12(9(7-8)13(18)19)20-14-16-10-3-1-2-4-11(10)17-14/h1-7H,(H,16,17)(H,18,19) |
| InChIKey | LTOJSQRDIUPSNY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |