C14H14N2O3S — CID 145098806
5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid;ethane (PubChem CID 145098806) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid;ethane.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145098806 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)furan-2-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C12H8N2O3S.C2H6/c15-11(16)9-5-6-10(17-9)18-12-13-7-3-1-2-4-8(7)14-12;1-2/h1-6H,(H,13,14)(H,15,16);1-2H3 |
| InChIKey | PARFCDWMXCRWMQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |