C20H16N4O3S — CID 3525797
N-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-methoxybenzamide (PubChem CID 3525797) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3525797 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NN=Cc1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C20H16N4O3S/c1-26-17-9-5-2-6-14(17)19(25)24-21-12-13-10-11-18(27-13)28-20-22-15-7-3-4-8-16(15)23-20/h2-12H,1H3,(H,22,23)(H,24,25) |
| InChIKey | VBWNZIUKQSSNAS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|