C19H13BrN4O3S — CID 56688169
N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-5-bromo-2-hydroxybenzamide (PubChem CID 56688169) has the molecular formula C19H13BrN4O3S and a molecular weight of 457.31 g/mol. Its IUPAC name is N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-5-bromo-2-hydroxybenzamide.
| Compound Name | N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 56688169 |
| Molecular Formula | C19H13BrN4O3S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-5-bromo-2-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2nc3ccccc3[nH]2)o1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C19H13BrN4O3S/c20-11-5-7-16(25)13(9-11)18(26)24-21-10-12-6-8-17(27-12)28-19-22-14-3-1-2-4-15(14)23-19/h1-10,25H,(H,22,23)(H,24,26)/b21-10+ |
| InChIKey | YTLZXKIRAQEVIA-UFFVCSGVSA-N |
| XLogP | 4.54 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|