C20H15BrN2O5 — CID 98089013
methyl 3-[5-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 98089013) has the molecular formula C20H15BrN2O5 and a molecular weight of 443.25 g/mol. Its IUPAC name is methyl 3-[5-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 98089013 |
| Molecular Formula | C20H15BrN2O5 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | methyl 3-[5-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(/C=N/NC(=O)c3cc(Br)ccc3O)o2)c1 |
| InChI | InChI=1S/C20H15BrN2O5/c1-27-20(26)13-4-2-3-12(9-13)18-8-6-15(28-18)11-22-23-19(25)16-10-14(21)5-7-17(16)24/h2-11,24H,1H3,(H,23,25)/b22-11+ |
| InChIKey | SXEGWRCCIYUAQA-SSDVNMTOSA-N |
| XLogP | 3.97 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|