C19H15BrN2O4 — CID 126398281
N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126398281) has the molecular formula C19H15BrN2O4 and a molecular weight of 415.24 g/mol. Its IUPAC name is N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126398281 |
| Molecular Formula | C19H15BrN2O4 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(-c3ccc(Br)cc3)o2)c(O)c1 |
| InChI | InChI=1S/C19H15BrN2O4/c1-25-14-6-8-16(17(23)10-14)19(24)22-21-11-15-7-9-18(26-15)12-2-4-13(20)5-3-12/h2-11,23H,1H3,(H,22,24)/b21-11- |
| InChIKey | ZSCJDRZSIDIMEH-NHDPSOOVSA-N |
| XLogP | 4.19 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|