C20H13ClFN5O2S — CID 163326645
N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-4-cyano-2-fluorobenzamide;hydrochloride (PubChem CID 163326645) has the molecular formula C20H13ClFN5O2S and a molecular weight of 441.88 g/mol. Its IUPAC name is N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-4-cyano-2-fluorobenzamide;hydrochloride.
| Compound Name | N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-4-cyano-2-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 163326645 |
| Molecular Formula | C20H13ClFN5O2S |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | N-[(E)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-4-cyano-2-fluorobenzamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc(C(=O)N/N=C/c2ccc(Sc3nc4ccccc4[nH]3)o2)c(F)c1 |
| InChI | InChI=1S/C20H12FN5O2S.ClH/c21-15-9-12(10-22)5-7-14(15)19(27)26-23-11-13-6-8-18(28-13)29-20-24-16-3-1-2-4-17(16)25-20;/h1-9,11H,(H,24,25)(H,26,27);1H/b23-11+; |
| InChIKey | DOCDZLBJQPOHAC-YDLOHEMZSA-N |
| XLogP | 4.50 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|