C22H16N4O2S — CID 21212311
(Z)-3-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 21212311) has the molecular formula C22H16N4O2S and a molecular weight of 400.46 g/mol. Its IUPAC name is (Z)-3-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21212311 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (Z)-3-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2ccc(Sc3nc4ccccc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C22H16N4O2S/c1-14-6-8-16(9-7-14)24-21(27)15(13-23)12-17-10-11-20(28-17)29-22-25-18-4-2-3-5-19(18)26-22/h2-12H,1H3,(H,24,27)(H,25,26)/b15-12- |
| InChIKey | UMLZLDZVORNOSW-QINSGFPZSA-N |
| XLogP | 5.16 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|