C23H18N2O4 — CID 2713030
methyl 2-[5-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 2713030) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is methyl 2-[5-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2713030 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | methyl 2-[5-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2)o1 |
| InChI | InChI=1S/C23H18N2O4/c1-15-7-9-17(10-8-15)25-22(26)16(14-24)13-18-11-12-21(29-18)19-5-3-4-6-20(19)23(27)28-2/h3-13H,1-2H3,(H,25,26)/b16-13+ |
| InChIKey | DDZYLPLAGBBLTL-DTQAZKPQSA-N |
| XLogP | 4.59 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|