C22H15ClN2O4 — CID 1355661
2-[5-[3-(3-chloro-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 1355661) has the molecular formula C22H15ClN2O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is 2-[5-[3-(3-chloro-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[3-(3-chloro-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1355661 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[5-[3-(3-chloro-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)C(C#N)=Cc2ccc(-c3ccccc3C(=O)O)o2)cc1Cl |
| InChI | InChI=1S/C22H15ClN2O4/c1-13-6-7-15(11-19(13)23)25-21(26)14(12-24)10-16-8-9-20(29-16)17-4-2-3-5-18(17)22(27)28/h2-11H,1H3,(H,25,26)(H,27,28) |
| InChIKey | CBAROPJUJNLTLG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|