C21H13ClN2O4 — CID 2023624
3-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]-4-chlorobenzoic acid (PubChem CID 2023624) has the molecular formula C21H13ClN2O4 and a molecular weight of 392.80 g/mol. Its IUPAC name is 3-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]-4-chlorobenzoic acid.
| Compound Name | 3-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 2023624 |
| Molecular Formula | C21H13ClN2O4 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]-4-chlorobenzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2cc(C(=O)O)ccc2Cl)o1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H13ClN2O4/c22-18-8-6-13(21(26)27)11-17(18)19-9-7-16(28-19)10-14(12-23)20(25)24-15-4-2-1-3-5-15/h1-11H,(H,24,25)(H,26,27)/b14-10+ |
| InChIKey | QPIXCAWNPANWIQ-GXDHUFHOSA-N |
| XLogP | 4.84 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|