C21H13Cl2N3O3 — CID 6290779
N'-[(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]benzohydrazide (PubChem CID 6290779) has the molecular formula C21H13Cl2N3O3 and a molecular weight of 426.26 g/mol. Its IUPAC name is N'-[(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 6290779 |
| Molecular Formula | C21H13Cl2N3O3 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N'-[(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]benzohydrazide |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H13Cl2N3O3/c22-15-6-8-18(23)17(11-15)19-9-7-16(29-19)10-14(12-24)21(28)26-25-20(27)13-4-2-1-3-5-13/h1-11H,(H,25,27)(H,26,28)/b14-10+ |
| InChIKey | LKLXEDOPWFKDHN-GXDHUFHOSA-N |
| XLogP | 4.62 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|