C21H13Cl2FN2O2 — CID 171132338
2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(4-fluoro-3-methylphenyl)prop-2-enamide (PubChem CID 171132338) has the molecular formula C21H13Cl2FN2O2 and a molecular weight of 415.25 g/mol. Its IUPAC name is 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(4-fluoro-3-methylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(4-fluoro-3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 171132338 |
| Molecular Formula | C21H13Cl2FN2O2 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(4-fluoro-3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)C(C#N)=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)ccc1F |
| InChI | InChI=1S/C21H13Cl2FN2O2/c1-12-8-15(3-6-19(12)24)26-21(27)13(11-25)9-16-4-7-20(28-16)17-10-14(22)2-5-18(17)23/h2-10H,1H3,(H,26,27) |
| InChIKey | FTVJYMXNDSTEHV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|