C23H16ClN2O4- — CID 4582839
2-chloro-5-[5-[2-cyano-3-(3,4-dimethylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 4582839) has the molecular formula C23H16ClN2O4- and a molecular weight of 419.84 g/mol. Its IUPAC name is 2-chloro-5-[5-[2-cyano-3-(3,4-dimethylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[2-cyano-3-(3,4-dimethylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4582839 |
| Molecular Formula | C23H16ClN2O4- |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-chloro-5-[5-[2-cyano-3-(3,4-dimethylanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | Cc1ccc(NC(=O)C(C#N)=Cc2ccc(-c3ccc(Cl)c(C(=O)[O-])c3)o2)cc1C |
| InChI | InChI=1S/C23H17ClN2O4/c1-13-3-5-17(9-14(13)2)26-22(27)16(12-25)10-18-6-8-21(30-18)15-4-7-20(24)19(11-15)23(28)29/h3-11H,1-2H3,(H,26,27)(H,28,29)/p-1 |
| InChIKey | YCDWMHBQBXKUHW-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|