C20H12Cl2N2O2 — CID 18863623
(E)-2-cyano-N-(3,4-dichlorophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 18863623) has the molecular formula C20H12Cl2N2O2 and a molecular weight of 383.23 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dichlorophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dichlorophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18863623 |
| Molecular Formula | C20H12Cl2N2O2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dichlorophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2)o1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H12Cl2N2O2/c21-17-8-6-15(11-18(17)22)24-20(25)14(12-23)10-16-7-9-19(26-16)13-4-2-1-3-5-13/h1-11H,(H,24,25)/b14-10+ |
| InChIKey | JKMRWZABQVUHSS-GXDHUFHOSA-N |
| XLogP | 5.80 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|