C20H13ClN2O2 — CID 796826
3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 796826) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 796826 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Cl)cc2)o1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-8-6-14(7-9-16)19-11-10-18(25-19)12-15(13-22)20(24)23-17-4-2-1-3-5-17/h1-12H,(H,23,24) |
| InChIKey | MSKAEMIYLOHICM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|