C21H13N2O4- — CID 7299730
4-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 7299730) has the molecular formula C21H13N2O4- and a molecular weight of 357.35 g/mol. Its IUPAC name is 4-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | 4-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7299730 |
| Molecular Formula | C21H13N2O4- |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[5-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(C(=O)[O-])cc2)o1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H14N2O4/c22-13-16(20(24)23-17-4-2-1-3-5-17)12-18-10-11-19(27-18)14-6-8-15(9-7-14)21(25)26/h1-12H,(H,23,24)(H,25,26)/p-1/b16-12+ |
| InChIKey | IZEUVKTXARAZPL-FOWTUZBSSA-M |
| XLogP | 2.86 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|