C23H18N2O5 — CID 1269200
4-[5-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 1269200) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[5-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1269200 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[5-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | CCOc1ccc(NC(=O)C(C#N)=Cc2ccc(-c3ccc(C(=O)O)cc3)o2)cc1 |
| InChI | InChI=1S/C23H18N2O5/c1-2-29-19-9-7-18(8-10-19)25-22(26)17(14-24)13-20-11-12-21(30-20)15-3-5-16(6-4-15)23(27)28/h3-13H,2H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | AVXNBAYOVPECSG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|