C23H17N2O5- — CID 7326875
3-[5-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 7326875) has the molecular formula C23H17N2O5- and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-[5-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7326875 |
| Molecular Formula | C23H17N2O5- |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[5-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2ccc(-c3cccc(C(=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C23H18N2O5/c1-2-29-19-8-6-18(7-9-19)25-22(26)17(14-24)13-20-10-11-21(30-20)15-4-3-5-16(12-15)23(27)28/h3-13H,2H2,1H3,(H,25,26)(H,27,28)/p-1/b17-13+ |
| InChIKey | SWPJIHDZLLHPFW-GHRIWEEISA-M |
| XLogP | 3.25 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|