C23H17N3O3 — CID 126029229
(Z)-2-cyano-3-[5-(4-cyanophenyl)furan-2-yl]-N-(3-ethoxyphenyl)prop-2-enamide (PubChem CID 126029229) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(4-cyanophenyl)furan-2-yl]-N-(3-ethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(4-cyanophenyl)furan-2-yl]-N-(3-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126029229 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (Z)-2-cyano-3-[5-(4-cyanophenyl)furan-2-yl]-N-(3-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cccc(NC(=O)/C(C#N)=C\c2ccc(-c3ccc(C#N)cc3)o2)c1 |
| InChI | InChI=1S/C23H17N3O3/c1-2-28-20-5-3-4-19(13-20)26-23(27)18(15-25)12-21-10-11-22(29-21)17-8-6-16(14-24)7-9-17/h3-13H,2H2,1H3,(H,26,27)/b18-12- |
| InChIKey | FFTYLAPCFIEQQA-PDGQHHTCSA-N |
| XLogP | 4.76 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|