C22H14N2O6 — CID 45326893
4-[5-[(E)-3-(4-carboxyanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 45326893) has the molecular formula C22H14N2O6 and a molecular weight of 402.36 g/mol. Its IUPAC name is 4-[5-[(E)-3-(4-carboxyanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-3-(4-carboxyanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 45326893 |
| Molecular Formula | C22H14N2O6 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-[5-[(E)-3-(4-carboxyanilino)-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(C(=O)O)cc2)o1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H14N2O6/c23-12-16(20(25)24-17-7-5-15(6-8-17)22(28)29)11-18-9-10-19(30-18)13-1-3-14(4-2-13)21(26)27/h1-11H,(H,24,25)(H,26,27)(H,28,29)/b16-11+ |
| InChIKey | ZPDJDUNTLRTLHA-LFIBNONCSA-N |
| XLogP | 3.89 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|