C20H16N4O6S2 — CID 3137858
2-cyano-N-(4-sulfamoylphenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 3137858) has the molecular formula C20H16N4O6S2 and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-cyano-N-(4-sulfamoylphenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(4-sulfamoylphenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3137858 |
| Molecular Formula | C20H16N4O6S2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-cyano-N-(4-sulfamoylphenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc(S(N)(=O)=O)cc2)o1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H16N4O6S2/c21-12-14(20(25)24-15-3-8-18(9-4-15)32(23,28)29)11-16-5-10-19(30-16)13-1-6-17(7-2-13)31(22,26)27/h1-11H,(H,24,25)(H2,22,26,27)(H2,23,28,29) |
| InChIKey | VQXXLCRMLNJLNR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 186.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|