C20H13Cl2N3O4S — CID 1070895
(E)-2-cyano-N-(2,5-dichlorophenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 1070895) has the molecular formula C20H13Cl2N3O4S and a molecular weight of 462.31 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dichlorophenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1070895 |
| Molecular Formula | C20H13Cl2N3O4S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(S(N)(=O)=O)cc2)o1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H13Cl2N3O4S/c21-14-3-7-17(22)18(10-14)25-20(26)13(11-23)9-15-4-8-19(29-15)12-1-5-16(6-2-12)30(24,27)28/h1-10H,(H,25,26)(H2,24,27,28)/b13-9+ |
| InChIKey | NIZSNHFCDAWDMY-UKTHLTGXSA-N |
| XLogP | 4.45 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|