C14H11N3O3S2 — CID 3444453
2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enethioamide (PubChem CID 3444453) has the molecular formula C14H11N3O3S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enethioamide.
| Compound Name | 2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 3444453 |
| Molecular Formula | C14H11N3O3S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enethioamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc(S(N)(=O)=O)cc2)o1)C(N)=S |
| InChI | InChI=1S/C14H11N3O3S2/c15-8-10(14(16)21)7-11-3-6-13(20-11)9-1-4-12(5-2-9)22(17,18)19/h1-7H,(H2,16,21)(H2,17,18,19) |
| InChIKey | LPTDKZFNDFNCOR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|