C19H19N3O5S — CID 6384496
(Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 6384496) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6384496 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(S(N)(=O)=O)cc2)o1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C19H19N3O5S/c20-11-14(19(23)22-12-16-2-1-9-26-16)10-15-5-8-18(27-15)13-3-6-17(7-4-13)28(21,24)25/h3-8,10,16H,1-2,9,12H2,(H,22,23)(H2,21,24,25)/b14-10- |
| InChIKey | BJSCZAQCAJZUGF-UVTDQMKNSA-N |
| XLogP | 1.80 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|