C20H16ClN2O5- — CID 2218040
2-chloro-5-[5-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]furan-2-yl]benzoate (PubChem CID 2218040) has the molecular formula C20H16ClN2O5- and a molecular weight of 399.81 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]furan-2-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2218040 |
| Molecular Formula | C20H16ClN2O5- |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-chloro-5-[5-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]furan-2-yl]benzoate |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)c(C(=O)[O-])c2)o1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H17ClN2O5/c21-17-5-3-12(9-16(17)20(25)26)18-6-4-14(28-18)8-13(10-22)19(24)23-11-15-2-1-7-27-15/h3-6,8-9,15H,1-2,7,11H2,(H,23,24)(H,25,26)/p-1/b13-8+/t15-/m1/s1 |
| InChIKey | UQVFSWMCQXXJRM-XETPBLJFSA-M |
| XLogP | 2.17 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|