C16H8F6N2OS — CID 2803974
3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enethioamide (PubChem CID 2803974) has the molecular formula C16H8F6N2OS and a molecular weight of 390.31 g/mol. Its IUPAC name is 3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enethioamide.
| Compound Name | 3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 2803974 |
| Molecular Formula | C16H8F6N2OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enethioamide |
| SMILES | N#CC(=Cc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1)C(N)=S |
| InChI | InChI=1S/C16H8F6N2OS/c17-15(18,19)10-3-8(4-11(6-10)16(20,21)22)13-2-1-12(25-13)5-9(7-23)14(24)26/h1-6H,(H2,24,26) |
| InChIKey | ZUQIIMJFUWWUPT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|