C14H8Cl2N2OS — CID 2979672
2-cyano-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enethioamide (PubChem CID 2979672) has the molecular formula C14H8Cl2N2OS and a molecular weight of 323.20 g/mol. Its IUPAC name is 2-cyano-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enethioamide.
| Compound Name | 2-cyano-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 2979672 |
| Molecular Formula | C14H8Cl2N2OS |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-cyano-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enethioamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)C(N)=S |
| InChI | InChI=1S/C14H8Cl2N2OS/c15-9-1-3-11(12(16)6-9)13-4-2-10(19-13)5-8(7-17)14(18)20/h1-6H,(H2,18,20) |
| InChIKey | ZEFJBLIPDRCXKO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|