C17H8Cl2N4O — CID 1154587
(3E)-2-amino-4-[5-(2,4-dichlorophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 1154587) has the molecular formula C17H8Cl2N4O and a molecular weight of 355.18 g/mol. Its IUPAC name is (3E)-2-amino-4-[5-(2,4-dichlorophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3E)-2-amino-4-[5-(2,4-dichlorophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 1154587 |
| Molecular Formula | C17H8Cl2N4O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (3E)-2-amino-4-[5-(2,4-dichlorophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C17H8Cl2N4O/c18-12-1-3-14(15(19)6-12)16-4-2-13(24-16)5-10(7-20)17(23)11(8-21)9-22/h1-6H,23H2/b10-5- |
| InChIKey | RGWNFJMKPBKWEQ-YHYXMXQVSA-N |
| XLogP | 4.42 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|