C19H9N5O3 — CID 3594860
2-amino-4-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 3594860) has the molecular formula C19H9N5O3 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-amino-4-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 3594860 |
| Molecular Formula | C19H9N5O3 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-amino-4-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C19H9N5O3/c20-7-11(17(23)12(8-21)9-22)5-13-2-4-16(27-13)10-1-3-14-15(6-10)19(26)24-18(14)25/h1-6H,23H2,(H,24,25,26) |
| InChIKey | XJIVNXIIFPRRQK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|