C18H12N2O5 — CID 727336
ethyl 2-cyano-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enoate (PubChem CID 727336) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is ethyl 2-cyano-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 727336 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | ethyl 2-cyano-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1 |
| InChI | InChI=1S/C18H12N2O5/c1-2-24-18(23)11(9-19)7-12-4-6-15(25-12)10-3-5-13-14(8-10)17(22)20-16(13)21/h3-8H,2H2,1H3,(H,20,21,22) |
| InChIKey | QOSDASAKAOGNOK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|