C18H16N2O6S — CID 1273104
ethyl (E)-3-[5-[4-(acetylsulfamoyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoate (PubChem CID 1273104) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is ethyl (E)-3-[5-[4-(acetylsulfamoyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[5-[4-(acetylsulfamoyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 1273104 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | ethyl (E)-3-[5-[4-(acetylsulfamoyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(-c2ccc(S(=O)(=O)NC(C)=O)cc2)o1 |
| InChI | InChI=1S/C18H16N2O6S/c1-3-25-18(22)14(11-19)10-15-6-9-17(26-15)13-4-7-16(8-5-13)27(23,24)20-12(2)21/h4-10H,3H2,1-2H3,(H,20,21)/b14-10+ |
| InChIKey | OOBGXPGKADJRPY-GXDHUFHOSA-N |
| XLogP | 2.24 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|