C21H21NO5 — CID 6370746
butyl 4-[5-[(Z)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 6370746) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is butyl 4-[5-[(Z)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(Z)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6370746 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | butyl 4-[5-[(Z)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)C(=O)OCC)o2)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-3-5-12-26-20(23)16-8-6-15(7-9-16)19-11-10-18(27-19)13-17(14-22)21(24)25-4-2/h6-11,13H,3-5,12H2,1-2H3/b17-13- |
| InChIKey | IKNWGGMEEKSGHG-LGMDPLHJSA-N |
| XLogP | 4.37 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|