C35H49NO5 — CID 6238287
decyl 4-[5-[(E)-2-cyano-3-decoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 6238287) has the molecular formula C35H49NO5 and a molecular weight of 563.78 g/mol. Its IUPAC name is decyl 4-[5-[(E)-2-cyano-3-decoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | decyl 4-[5-[(E)-2-cyano-3-decoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6238287 |
| Molecular Formula | C35H49NO5 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | decyl 4-[5-[(E)-2-cyano-3-decoxy-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)/C(C#N)=C/c1ccc(-c2ccc(C(=O)OCCCCCCCCCC)cc2)o1 |
| InChI | InChI=1S/C35H49NO5/c1-3-5-7-9-11-13-15-17-25-39-34(37)30-21-19-29(20-22-30)33-24-23-32(41-33)27-31(28-36)35(38)40-26-18-16-14-12-10-8-6-4-2/h19-24,27H,3-18,25-26H2,1-2H3/b31-27+ |
| InChIKey | URBORYAYMWSVLN-TVKQRKNISA-N |
| XLogP | 9.83 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|