C17H10N4O4S — CID 50885714
4-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]benzenesulfonic acid (PubChem CID 50885714) has the molecular formula C17H10N4O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 4-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]benzenesulfonic acid.
| Compound Name | 4-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 50885714 |
| Molecular Formula | C17H10N4O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]benzenesulfonic acid |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C/c1ccc(-c2ccc(S(=O)(=O)O)cc2)o1 |
| InChI | InChI=1S/C17H10N4O4S/c18-8-12(17(21)13(9-19)10-20)7-14-3-6-16(25-14)11-1-4-15(5-2-11)26(22,23)24/h1-7H,21H2,(H,22,23,24)/b12-7+ |
| InChIKey | QOQHQZCXSIBJPN-KPKJPENVSA-N |
| XLogP | 2.36 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|