C17H9N5O3 — CID 4736035
2-amino-4-[5-(4-nitrophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 4736035) has the molecular formula C17H9N5O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-amino-4-[5-(4-nitrophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-[5-(4-nitrophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 4736035 |
| Molecular Formula | C17H9N5O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-amino-4-[5-(4-nitrophenyl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C17H9N5O3/c18-8-12(17(21)13(9-19)10-20)7-15-5-6-16(25-15)11-1-3-14(4-2-11)22(23)24/h1-7H,21H2 |
| InChIKey | IWIIUIFMARKIEK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|