C14H8N4O6 — CID 94844730
(E)-2-cyano-3-[5-(3,5-dinitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 94844730) has the molecular formula C14H8N4O6 and a molecular weight of 328.24 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(3,5-dinitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(3,5-dinitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 94844730 |
| Molecular Formula | C14H8N4O6 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (E)-2-cyano-3-[5-(3,5-dinitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)o1)C(N)=O |
| InChI | InChI=1S/C14H8N4O6/c15-7-9(14(16)19)5-12-1-2-13(24-12)8-3-10(17(20)21)6-11(4-8)18(22)23/h1-6H,(H2,16,19)/b9-5+ |
| InChIKey | IPELSPSQZZPTIX-WEVVVXLNSA-N |
| XLogP | 2.16 |
| TPSA | 166.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|