C16H10N2O5S — CID 73380513
5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 73380513) has the molecular formula C16H10N2O5S and a molecular weight of 342.33 g/mol. Its IUPAC name is 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 73380513 |
| Molecular Formula | C16H10N2O5S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | N#CC(=Cc1ccc(-c2cc(C(=O)O)cc(C(=O)O)c2)o1)C(N)=S |
| InChI | InChI=1S/C16H10N2O5S/c17-7-11(14(18)24)6-12-1-2-13(23-12)8-3-9(15(19)20)5-10(4-8)16(21)22/h1-6H,(H2,18,24)(H,19,20)(H,21,22) |
| InChIKey | NYZFINHXAFHHND-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|