C23H16N2O7 — CID 1278429
5-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 1278429) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 5-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 1278429 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 5-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C/c1ccc(-c2cc(C(=O)O)cc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C23H16N2O7/c1-31-20-5-3-2-4-18(20)25-21(26)16(12-24)11-17-6-7-19(32-17)13-8-14(22(27)28)10-15(9-13)23(29)30/h2-11H,1H3,(H,25,26)(H,27,28)(H,29,30)/b16-11+ |
| InChIKey | CWJFGGIDHLAFFV-LFIBNONCSA-N |
| XLogP | 3.90 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|